C12H17O4- — CID 139246308
3-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methylcyclohexen-1-olate (PubChem CID 139246308) has the molecular formula C12H17O4- and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methylcyclohexen-1-olate.
| Compound Name | 3-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methylcyclohexen-1-olate |
|---|---|
| PubChem CID | 139246308 |
| Molecular Formula | C12H17O4- |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methylcyclohexen-1-olate |
| SMILES | COC(=O)[C@@H](C(C)=O)C1CCCC([O-])=C1C |
| InChI | InChI=1S/C12H18O4/c1-7-9(5-4-6-10(7)14)11(8(2)13)12(15)16-3/h9,11,14H,4-6H2,1-3H3/p-1/t9?,11-/m0/s1 |
| InChIKey | KCVRWOJVYBXIKK-UMJHXOGRSA-M |
| XLogP | 0.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|