C16H14FN — CID 139247520
1-(2-fluorophenyl)-7-methyl-3,4-dihydroisoquinoline (PubChem CID 139247520) has the molecular formula C16H14FN and a molecular weight of 239.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-7-methyl-3,4-dihydroisoquinoline.
| Compound Name | 1-(2-fluorophenyl)-7-methyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 139247520 |
| Molecular Formula | C16H14FN |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(2-fluorophenyl)-7-methyl-3,4-dihydroisoquinoline |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1F)=NCC2 |
| InChI | InChI=1S/C16H14FN/c1-11-6-7-12-8-9-18-16(14(12)10-11)13-4-2-3-5-15(13)17/h2-7,10H,8-9H2,1H3 |
| InChIKey | GACWNBYAQUDCGZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |