C19H29BrN2O5S — CID 139247652
N-[4-[(1S,2S,3R)-2-bromo-3-propan-2-ylcyclohexyl]oxybutyl]-4-nitrobenzenesulfonamide (PubChem CID 139247652) has the molecular formula C19H29BrN2O5S and a molecular weight of 477.42 g/mol. Its IUPAC name is N-[4-[(1S,2S,3R)-2-bromo-3-propan-2-ylcyclohexyl]oxybutyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[(1S,2S,3R)-2-bromo-3-propan-2-ylcyclohexyl]oxybutyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 139247652 |
| Molecular Formula | C19H29BrN2O5S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[4-[(1S,2S,3R)-2-bromo-3-propan-2-ylcyclohexyl]oxybutyl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C)[C@H]1CCC[C@H](OCCCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1Br |
| InChI | InChI=1S/C19H29BrN2O5S/c1-14(2)17-6-5-7-18(19(17)20)27-13-4-3-12-21-28(25,26)16-10-8-15(9-11-16)22(23)24/h8-11,14,17-19,21H,3-7,12-13H2,1-2H3/t17-,18+,19+/m1/s1 |
| InChIKey | AFNZPYNEPNQMCZ-QYZOEREBSA-N |
| XLogP | 4.26 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|