C16H24N2O6S — CID 75376352
N-[4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-nitrobenzenesulfonamide (PubChem CID 75376352) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75376352 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-nitrobenzenesulfonamide |
| SMILES | CCC(C)(CCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C1OCCO1 |
| InChI | InChI=1S/C16H24N2O6S/c1-3-16(2,15-23-11-12-24-15)9-4-10-17-25(21,22)14-7-5-13(6-8-14)18(19)20/h5-8,15,17H,3-4,9-12H2,1-2H3 |
| InChIKey | UGGMCTUATHIXOS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|