C36H22N6O2Ru+2 — CID 139247796
bis(1,10-phenanthroline);1,10-phenanthroline-5,6-dione;ruthenium(2+) (PubChem CID 139247796) has the molecular formula C36H22N6O2Ru+2 and a molecular weight of 671.68 g/mol. Its IUPAC name is bis(1,10-phenanthroline);1,10-phenanthroline-5,6-dione;ruthenium(2+).
| Compound Name | bis(1,10-phenanthroline);1,10-phenanthroline-5,6-dione;ruthenium(2+) |
|---|---|
| PubChem CID | 139247796 |
| Molecular Formula | C36H22N6O2Ru+2 |
| Molecular Weight | 671.68 g/mol |
| Exact Mass | 672.08 |
| IUPAC Name | bis(1,10-phenanthroline);1,10-phenanthroline-5,6-dione;ruthenium(2+) |
| SMILES | O=C1C(=O)c2cccnc2-c2ncccc21.[Ru+2].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H6N2O2.2C12H8N2.Ru/c15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-6H;2*1-8H;/q;;;+2 |
| InChIKey | NZUXBSXKZWINNZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|