C18H24O5 — CID 139248137
[(1R,3aR,6aS)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 139248137) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(1R,3aR,6aS)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1R,3aR,6aS)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 139248137 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(1R,3aR,6aS)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)O[C@@H]1CC[C@@H]3CCC(=O)[C@@H]31)OC2=O |
| InChI | InChI=1S/C18H24O5/c1-16(2)17(3)8-9-18(16,23-14(17)20)15(21)22-12-7-5-10-4-6-11(19)13(10)12/h10,12-13H,4-9H2,1-3H3/t10-,12+,13+,17-,18+/m0/s1 |
| InChIKey | AVDRAKUHBQLADM-IAAQCEKXSA-N |
| XLogP | 2.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |