C19H26O6 — CID 100995835
[(1S,2S,5R)-1,5-dimethyl-3-oxo-8-oxabicyclo[3.2.1]octan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 100995835) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1S,2S,5R)-1,5-dimethyl-3-oxo-8-oxabicyclo[3.2.1]octan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1S,2S,5R)-1,5-dimethyl-3-oxo-8-oxabicyclo[3.2.1]octan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 100995835 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(1S,2S,5R)-1,5-dimethyl-3-oxo-8-oxabicyclo[3.2.1]octan-2-yl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)O[C@@H]1C(=O)C[C@@]3(C)CC[C@]1(C)O3)OC2=O |
| InChI | InChI=1S/C19H26O6/c1-15(2)17(4)7-9-19(15,24-13(17)21)14(22)23-12-11(20)10-16(3)6-8-18(12,5)25-16/h12H,6-10H2,1-5H3/t12-,16-,17+,18+,19-/m1/s1 |
| InChIKey | RJCARAYHCZKRCV-RJMHMIJWSA-N |
| XLogP | 2.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |