C18H27NO3 — CID 139248307
(1R,2S,3R,4S)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 139248307) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,3R,4S)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 139248307 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | COc1ccc(O)c(CN[C@@H]2[C@H]3CC[C@@](C)([C@@H]2O)C3(C)C)c1 |
| InChI | InChI=1S/C18H27NO3/c1-17(2)13-7-8-18(17,3)16(21)15(13)19-10-11-9-12(22-4)5-6-14(11)20/h5-6,9,13,15-16,19-21H,7-8,10H2,1-4H3/t13-,15-,16-,18+/m1/s1 |
| InChIKey | ZHFDGTZFKUSRLO-IIVZCXTMSA-N |
| XLogP | 2.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|