C40H32O10S — CID 139248586
[3,4,5-tribenzoyloxy-6-[(R)-phenylsulfinyl]oxan-2-yl]methyl benzoate (PubChem CID 139248586) has the molecular formula C40H32O10S and a molecular weight of 704.75 g/mol. Its IUPAC name is [3,4,5-tribenzoyloxy-6-[(R)-phenylsulfinyl]oxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-tribenzoyloxy-6-[(R)-phenylsulfinyl]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 139248586 |
| Molecular Formula | C40H32O10S |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.17 |
| IUPAC Name | [3,4,5-tribenzoyloxy-6-[(R)-phenylsulfinyl]oxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC([S@](=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32O10S/c41-36(27-16-6-1-7-17-27)46-26-32-33(48-37(42)28-18-8-2-9-19-28)34(49-38(43)29-20-10-3-11-21-29)35(50-39(44)30-22-12-4-13-23-30)40(47-32)51(45)31-24-14-5-15-25-31/h1-25,32-35,40H,26H2/t32?,33?,34?,35?,40?,51-/m1/s1 |
| InChIKey | ADQWBSOAIRYGLI-INGYTLDOSA-N |
| XLogP | 6.05 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|