C33H31N5O4 — CID 139248665
ethyl 1,6-bis(4-methoxyphenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate (PubChem CID 139248665) has the molecular formula C33H31N5O4 and a molecular weight of 561.64 g/mol. Its IUPAC name is ethyl 1,6-bis(4-methoxyphenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate.
| Compound Name | ethyl 1,6-bis(4-methoxyphenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate |
|---|---|
| PubChem CID | 139248665 |
| Molecular Formula | C33H31N5O4 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | ethyl 1,6-bis(4-methoxyphenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate |
| SMILES | CCOC(=O)C1N(c2ccc(OC)cc2)N=C(c2ccccc2)C2N(c3ccc(OC)cc3)N=C(c3ccccc3)N12 |
| InChI | InChI=1S/C33H31N5O4/c1-4-42-33(39)32-36-30(24-13-9-6-10-14-24)35-37(25-15-19-27(40-2)20-16-25)31(36)29(23-11-7-5-8-12-23)34-38(32)26-17-21-28(41-3)22-18-26/h5-22,31-32H,4H2,1-3H3 |
| InChIKey | ZNEBZNALJJUPTP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 79.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |