C28H25NO4 — CID 139249402
ethyl 2-benzyl-1,3-dioxo-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f]isoindole-6-carboxylate (PubChem CID 139249402) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl 2-benzyl-1,3-dioxo-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f]isoindole-6-carboxylate.
| Compound Name | ethyl 2-benzyl-1,3-dioxo-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f]isoindole-6-carboxylate |
|---|---|
| PubChem CID | 139249402 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl 2-benzyl-1,3-dioxo-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f]isoindole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(c1ccccc1)C1C(=O)N(Cc3ccccc3)C(=O)C1C2 |
| InChI | InChI=1S/C28H25NO4/c1-2-33-28(32)21-14-13-20-15-23-25(24(22(20)16-21)19-11-7-4-8-12-19)27(31)29(26(23)30)17-18-9-5-3-6-10-18/h3-14,16,23-25H,2,15,17H2,1H3 |
| InChIKey | WELVFMOGLPQULQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|