C17H22O3 — CID 139249544
(4S,9S)-9,13-dimethyl-5,12-dioxapentacyclo[11.2.1.111,14.01,10.04,9]heptadec-2-en-6-one (PubChem CID 139249544) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4S,9S)-9,13-dimethyl-5,12-dioxapentacyclo[11.2.1.111,14.01,10.04,9]heptadec-2-en-6-one.
| Compound Name | (4S,9S)-9,13-dimethyl-5,12-dioxapentacyclo[11.2.1.111,14.01,10.04,9]heptadec-2-en-6-one |
|---|---|
| PubChem CID | 139249544 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4S,9S)-9,13-dimethyl-5,12-dioxapentacyclo[11.2.1.111,14.01,10.04,9]heptadec-2-en-6-one |
| SMILES | CC12CC34C=C[C@@H]5OC(=O)CC[C@@]5(C)C3C(CC1C4)O2 |
| InChI | InChI=1S/C17H22O3/c1-15-5-4-13(18)19-12(15)3-6-17-8-10-7-11(14(15)17)20-16(10,2)9-17/h3,6,10-12,14H,4-5,7-9H2,1-2H3/t10?,11?,12-,14?,15+,16?,17?/m0/s1 |
| InChIKey | FKQFZNDUCUNSRR-AWZUPJASSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|