C14H20O — CID 102415613
(1S,6S,7S,9S,10S)-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene (PubChem CID 102415613) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,6S,7S,9S,10S)-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene.
| Compound Name | (1S,6S,7S,9S,10S)-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene |
|---|---|
| PubChem CID | 102415613 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,6S,7S,9S,10S)-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene |
| SMILES | CC1CC=C[C@]23C[C@H]4C[C@H](O[C@@]4(C)C2)[C@@H]13 |
| InChI | InChI=1S/C14H20O/c1-9-4-3-5-14-7-10-6-11(12(9)14)15-13(10,2)8-14/h3,5,9-12H,4,6-8H2,1-2H3/t9?,10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | UHQIKMOUVFIDPV-AKIKKLFKSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|