C10H18 — CID 101032290
3,3,6-trimethyl(1,2-13C2)cycloheptene (PubChem CID 101032290) has the molecular formula C10H18 and a molecular weight of 140.24 g/mol. Its IUPAC name is 3,3,6-trimethyl(1,2-13C2)cycloheptene.
| Compound Name | 3,3,6-trimethyl(1,2-13C2)cycloheptene |
|---|---|
| PubChem CID | 101032290 |
| Molecular Formula | C10H18 |
| Molecular Weight | 140.24 g/mol |
| Exact Mass | 140.15 |
| IUPAC Name | 3,3,6-trimethyl(1,2-13C2)cycloheptene |
| SMILES | CC1CCC(C)(C)[13CH]=[13CH]C1 |
| InChI | InChI=1S/C10H18/c1-9-5-4-7-10(2,3)8-6-9/h4,7,9H,5-6,8H2,1-3H3/i4+1,7+1 |
| InChIKey | LETIKQYYDQVIHG-DDHYBHAWSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|