About (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene
(3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene (PubChem CID 162832197) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene |
| PubChem CID | 162832197 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene |
| SMILES | C[C@H]1CC=C[C@](C)(C2CCCCC2)C1 |
| InChI | InChI=1S/C14H24/c1-12-7-6-10-14(2,11-12)13-8-4-3-5-9-13/h6,10,12-13H,3-5,7-9,11H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | RGJVNFKSTVKQSA-JSGCOSHPSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene?
The IUPAC name of (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene (CID 162832197) is (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene.
What is the SMILES notation for (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene?
The canonical SMILES for (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene is C[C@H]1CC=C[C@](C)(C2CCCCC2)C1.
What is the InChIKey of (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene?
The InChIKey is RGJVNFKSTVKQSA-JSGCOSHPSA-N. The full InChI is InChI=1S/C14H24/c1-12-7-6-10-14(2,11-12)13-8-4-3-5-9-13/h6,10,12-13H,3-5,7-9,11H2,1-2H3/t12-,14-/m0/s1.
What are the key properties of (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene?
(3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene has a molecular weight of 192.35 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene is sourced from PubChem (CID 162832197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).