C14H24 — CID 162832197
(3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene (PubChem CID 162832197) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene.
| Compound Name | (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene |
|---|---|
| PubChem CID | 162832197 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3S,5S)-3-cyclohexyl-3,5-dimethylcyclohexene |
| SMILES | C[C@H]1CC=C[C@](C)(C2CCCCC2)C1 |
| InChI | InChI=1S/C14H24/c1-12-7-6-10-14(2,11-12)13-8-4-3-5-9-13/h6,10,12-13H,3-5,7-9,11H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | RGJVNFKSTVKQSA-JSGCOSHPSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|