C10H16 — CID 13074897
(3aS,7aS)-7a-methyl-1,2,3,3a,4,5-hexahydroindene (PubChem CID 13074897) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (3aS,7aS)-7a-methyl-1,2,3,3a,4,5-hexahydroindene.
| Compound Name | (3aS,7aS)-7a-methyl-1,2,3,3a,4,5-hexahydroindene |
|---|---|
| PubChem CID | 13074897 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (3aS,7aS)-7a-methyl-1,2,3,3a,4,5-hexahydroindene |
| SMILES | C[C@@]12C=CCC[C@@H]1CCC2 |
| InChI | InChI=1S/C10H16/c1-10-7-3-2-5-9(10)6-4-8-10/h3,7,9H,2,4-6,8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | AQCZBXDPLAWBMZ-ZJUUUORDSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|