C11H20 — CID 145030122
6a-methyl-2,3,3a,4-tetrahydro-1H-pentalene;ethane (PubChem CID 145030122) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 6a-methyl-2,3,3a,4-tetrahydro-1H-pentalene;ethane.
| Compound Name | 6a-methyl-2,3,3a,4-tetrahydro-1H-pentalene;ethane |
|---|---|
| PubChem CID | 145030122 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 6a-methyl-2,3,3a,4-tetrahydro-1H-pentalene;ethane |
| SMILES | CC.CC12C=CCC1CCC2 |
| InChI | InChI=1S/C9H14.C2H6/c1-9-6-2-4-8(9)5-3-7-9;1-2/h2,6,8H,3-5,7H2,1H3;1-2H3 |
| InChIKey | KEHJCFLMLAWNMY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|