C31H43NO — CID 163088220
3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(ethylaminomethyl)phenyl]methyl]phenol (PubChem CID 163088220) has the molecular formula C31H43NO and a molecular weight of 445.69 g/mol. Its IUPAC name is 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(ethylaminomethyl)phenyl]methyl]phenol.
| Compound Name | 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(ethylaminomethyl)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 163088220 |
| Molecular Formula | C31H43NO |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(ethylaminomethyl)phenyl]methyl]phenol |
| SMILES | CCNCc1ccccc1Cc1cc(O)cc(C[C@H]2CCC[C@H]([C@@]3(C)C=CC[C@H](C)C3)C2)c1 |
| InChI | InChI=1S/C31H43NO/c1-4-32-22-28-12-6-5-11-27(28)17-26-16-25(19-30(33)20-26)15-24-10-7-13-29(18-24)31(3)14-8-9-23(2)21-31/h5-6,8,11-12,14,16,19-20,23-24,29,32-33H,4,7,9-10,13,15,17-18,21-22H2,1-3H3/t23-,24+,29-,31-/m0/s1 |
| InChIKey | BAMHUWBHGBFMIO-OKABYJMHSA-N |
| XLogP | 7.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|