C12H22 — CID 59592096
(6R)-6-tert-butyl-3,3-dimethylcyclohexene (PubChem CID 59592096) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (6R)-6-tert-butyl-3,3-dimethylcyclohexene.
| Compound Name | (6R)-6-tert-butyl-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 59592096 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (6R)-6-tert-butyl-3,3-dimethylcyclohexene |
| SMILES | CC1(C)C=C[C@H](C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22/c1-11(2,3)10-6-8-12(4,5)9-7-10/h6,8,10H,7,9H2,1-5H3/t10-/m0/s1 |
| InChIKey | RWRUFXHXNCSNAC-JTQLQIEISA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|