C10H18O3 — CID 130152102
5-(2-hydroxypropan-2-yl)-2-methylcyclohex-3-ene-1,2-diol (PubChem CID 130152102) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 5-(2-hydroxypropan-2-yl)-2-methylcyclohex-3-ene-1,2-diol.
| Compound Name | 5-(2-hydroxypropan-2-yl)-2-methylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 130152102 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 5-(2-hydroxypropan-2-yl)-2-methylcyclohex-3-ene-1,2-diol |
| SMILES | CC(C)(O)C1C=CC(C)(O)C(O)C1 |
| InChI | InChI=1S/C10H18O3/c1-9(2,12)7-4-5-10(3,13)8(11)6-7/h4-5,7-8,11-13H,6H2,1-3H3 |
| InChIKey | OOJRSSYEQZCXGT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|