C9H14O — CID 124525372
(1S,2S,5S)-2-methylbicyclo[3.2.1]oct-3-en-2-ol (PubChem CID 124525372) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1S,2S,5S)-2-methylbicyclo[3.2.1]oct-3-en-2-ol.
| Compound Name | (1S,2S,5S)-2-methylbicyclo[3.2.1]oct-3-en-2-ol |
|---|---|
| PubChem CID | 124525372 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1S,2S,5S)-2-methylbicyclo[3.2.1]oct-3-en-2-ol |
| SMILES | C[C@@]1(O)C=C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H14O/c1-9(10)5-4-7-2-3-8(9)6-7/h4-5,7-8,10H,2-3,6H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | WFIKZJJNEDWFSX-HRDYMLBCSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|