C11H18 — CID 167650322
6-(1,1-dideuterioprop-1-en-2-yl)-3,3-dimethylcyclohexene (PubChem CID 167650322) has the molecular formula C11H18 and a molecular weight of 152.28 g/mol. Its IUPAC name is 6-(1,1-dideuterioprop-1-en-2-yl)-3,3-dimethylcyclohexene.
| Compound Name | 6-(1,1-dideuterioprop-1-en-2-yl)-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 167650322 |
| Molecular Formula | C11H18 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.15 |
| IUPAC Name | 6-(1,1-dideuterioprop-1-en-2-yl)-3,3-dimethylcyclohexene |
| SMILES | [2H]C([2H])=C(C)C1C=CC(C)(C)CC1 |
| InChI | InChI=1S/C11H18/c1-9(2)10-5-7-11(3,4)8-6-10/h5,7,10H,1,6,8H2,2-4H3/i1D2 |
| InChIKey | ZEHCXIOYWXOOCV-DICFDUPASA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|