C32H42O7 — CID 167599499
benzene-1,3,5-triol;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol;2-[(1R,6R)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3,5-triol (PubChem CID 167599499) has the molecular formula C32H42O7 and a molecular weight of 541.70 g/mol. Its IUPAC name is benzene-1,3,5-triol;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol;2-[(1R,6R)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3,5-triol.
| Compound Name | benzene-1,3,5-triol;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol;2-[(1R,6R)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 167599499 |
| Molecular Formula | C32H42O7 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | benzene-1,3,5-triol;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol;2-[(1R,6R)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3,5-triol |
| SMILES | C=C(C)[C@H]1C=C[C@@](C)(O)CC1.Oc1cc(O)cc(O)c1.[2H]C([2H])([2H])C1=C[C@@H](c2c(O)cc(O)cc2O)[C@H](C(=C)C)CC1 |
| InChI | InChI=1S/C16H20O3.C10H16O.C6H6O3/c1-9(2)12-5-4-10(3)6-13(12)16-14(18)7-11(17)8-15(16)19;1-8(2)9-4-6-10(3,11)7-5-9;7-4-1-5(8)3-6(9)2-4/h6-8,12-13,17-19H,1,4-5H2,2-3H3;4,6,9,11H,1,5,7H2,2-3H3;1-3,7-9H/t12-,13+;9-,10+;/m00./s1/i3D3;; |
| InChIKey | JNNLKTIPVDKJSJ-KXCHTRQQSA-N |
| XLogP | 6.90 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|