C27H36O3 — CID 123179131
5-ethyl-2-[3-methyl-6-[1-(1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyethenyl]cyclohex-2-en-1-yl]benzene-1,3-diol (PubChem CID 123179131) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 5-ethyl-2-[3-methyl-6-[1-(1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyethenyl]cyclohex-2-en-1-yl]benzene-1,3-diol.
| Compound Name | 5-ethyl-2-[3-methyl-6-[1-(1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyethenyl]cyclohex-2-en-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 123179131 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 5-ethyl-2-[3-methyl-6-[1-(1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyethenyl]cyclohex-2-en-1-yl]benzene-1,3-diol |
| SMILES | C=C(C)C1C=CC(C)(OC(=C)C2CCC(C)=CC2c2c(O)cc(CC)cc2O)CC1 |
| InChI | InChI=1S/C27H36O3/c1-7-20-15-24(28)26(25(29)16-20)23-14-18(4)8-9-22(23)19(5)30-27(6)12-10-21(11-13-27)17(2)3/h10,12,14-16,21-23,28-29H,2,5,7-9,11,13H2,1,3-4,6H3 |
| InChIKey | HSZVMIIMAONSBW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|