C10H16ArO — CID 159755681
argon;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol (PubChem CID 159755681) has the molecular formula C10H16ArO and a molecular weight of 192.18 g/mol. Its IUPAC name is argon;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol.
| Compound Name | argon;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 159755681 |
| Molecular Formula | C10H16ArO |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | argon;(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol |
| SMILES | C=C(C)[C@H]1C=C[C@@](C)(O)CC1.[Ar] |
| InChI | InChI=1S/C10H16O.Ar/c1-8(2)9-4-6-10(3,11)7-5-9;/h4,6,9,11H,1,5,7H2,2-3H3;/t9-,10+;/m0./s1 |
| InChIKey | NEFOJMKDZWQIHV-BAUSSPIASA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|