C20H36O3 — CID 140938948
1-[(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl]peroxydecan-1-ol (PubChem CID 140938948) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl]peroxydecan-1-ol.
| Compound Name | 1-[(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl]peroxydecan-1-ol |
|---|---|
| PubChem CID | 140938948 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 1-[(1S,4R)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl]peroxydecan-1-ol |
| SMILES | C=C(C)[C@H]1C=C[C@@](C)(OOC(O)CCCCCCCCC)CC1 |
| InChI | InChI=1S/C20H36O3/c1-5-6-7-8-9-10-11-12-19(21)22-23-20(4)15-13-18(14-16-20)17(2)3/h13,15,18-19,21H,2,5-12,14,16H2,1,3-4H3/t18-,19?,20+/m0/s1 |
| InChIKey | YHWXGFOGUACKBU-SJBAFXMYSA-N |
| XLogP | 5.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|