C12H22O3 — CID 20767220
4-[2-(2-hydroxyethoxy)propan-2-yl]-1-methylcyclohex-2-en-1-ol (PubChem CID 20767220) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)propan-2-yl]-1-methylcyclohex-2-en-1-ol.
| Compound Name | 4-[2-(2-hydroxyethoxy)propan-2-yl]-1-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 20767220 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)propan-2-yl]-1-methylcyclohex-2-en-1-ol |
| SMILES | CC1(O)C=CC(C(C)(C)OCCO)CC1 |
| InChI | InChI=1S/C12H22O3/c1-11(2,15-9-8-13)10-4-6-12(3,14)7-5-10/h4,6,10,13-14H,5,7-9H2,1-3H3 |
| InChIKey | OPMZIJQTECPFNA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|