C12H21NO4S — CID 134846460
(1R,4R)-4-(2-acetamidopropan-2-yl)-1-methylcyclohex-2-ene-1-sulfonic acid (PubChem CID 134846460) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is (1R,4R)-4-(2-acetamidopropan-2-yl)-1-methylcyclohex-2-ene-1-sulfonic acid.
| Compound Name | (1R,4R)-4-(2-acetamidopropan-2-yl)-1-methylcyclohex-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 134846460 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (1R,4R)-4-(2-acetamidopropan-2-yl)-1-methylcyclohex-2-ene-1-sulfonic acid |
| SMILES | CC(=O)NC(C)(C)[C@H]1C=C[C@](C)(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H21NO4S/c1-9(14)13-11(2,3)10-5-7-12(4,8-6-10)18(15,16)17/h5,7,10H,6,8H2,1-4H3,(H,13,14)(H,15,16,17)/t10-,12-/m0/s1 |
| InChIKey | WJGFIZIGKZRQQO-JQWIXIFHSA-N |
| XLogP | 1.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|