C18H26O4 — CID 25212583
ethyl (1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene-5-carboxylate (PubChem CID 25212583) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is ethyl (1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene-5-carboxylate.
| Compound Name | ethyl (1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene-5-carboxylate |
|---|---|
| PubChem CID | 25212583 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | ethyl (1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[C@@H]2[C@@H]3C[C@@H]4C[C@@]2(C=C[C@H]1OC)C[C@]4(C)O3 |
| InChI | InChI=1S/C18H26O4/c1-5-21-15(19)17(3)13(20-4)6-7-18-9-11-8-12(14(17)18)22-16(11,2)10-18/h6-7,11-14H,5,8-10H2,1-4H3/t11-,12+,13-,14+,16+,17-,18+/m1/s1 |
| InChIKey | PKQWRLSAYVVMJD-WAHZSDFYSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|