C20H32O4 — CID 25213637
ethyl 3-[(1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridecan-5-yl]propanoate (PubChem CID 25213637) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is ethyl 3-[(1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridecan-5-yl]propanoate.
| Compound Name | ethyl 3-[(1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridecan-5-yl]propanoate |
|---|---|
| PubChem CID | 25213637 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl 3-[(1S,4R,5S,6R,7S,9S,10S)-4-methoxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridecan-5-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@]1(C)[C@@H]2[C@@H]3C[C@@H]4C[C@@]2(CC[C@H]1OC)C[C@]4(C)O3 |
| InChI | InChI=1S/C20H32O4/c1-5-23-16(21)7-8-18(2)15(22-4)6-9-20-11-13-10-14(17(18)20)24-19(13,3)12-20/h13-15,17H,5-12H2,1-4H3/t13-,14+,15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | XEOJHKPAYLOMPN-RMPRSANRSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |