About ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate
ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate (PubChem CID 141313194) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate.
Analyze ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate?
The IUPAC name of ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate (CID 141313194) is ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate.
What is the SMILES notation for ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate?
The canonical SMILES for ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate is CCOC(=O)C12CC1CC1OC(C)OC12.
What is the InChIKey of ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate?
The InChIKey is XBNDFIFYUJFCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-13-10(12)11-5-7(11)4-8-9(11)15-6(2)14-8/h6-9H,3-5H2,1-2H3.
What are the key properties of ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate?
ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate has a molecular weight of 212.24 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-methyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate is sourced from PubChem (CID 141313194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).