C41H50O6S — CID 139249852
(2S,3S,4R,6S)-6-[(2R,3R)-2,3-bis(phenylmethoxy)butyl]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)-4-phenylmethoxyoxan-3-ol (PubChem CID 139249852) has the molecular formula C41H50O6S and a molecular weight of 670.91 g/mol. Its IUPAC name is (2S,3S,4R,6S)-6-[(2R,3R)-2,3-bis(phenylmethoxy)butyl]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)-4-phenylmethoxyoxan-3-ol.
| Compound Name | (2S,3S,4R,6S)-6-[(2R,3R)-2,3-bis(phenylmethoxy)butyl]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 139249852 |
| Molecular Formula | C41H50O6S |
| Molecular Weight | 670.91 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | (2S,3S,4R,6S)-6-[(2R,3R)-2,3-bis(phenylmethoxy)butyl]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)-4-phenylmethoxyoxan-3-ol |
| SMILES | CO[C@@]1(C(C)(C)CSc2ccccc2)O[C@H](C[C@@H](OCc2ccccc2)[C@@H](C)OCc2ccccc2)C[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C41H50O6S/c1-31(44-27-32-17-9-5-10-18-32)37(45-28-33-19-11-6-12-20-33)25-35-26-38(46-29-34-21-13-7-14-22-34)39(42)41(43-4,47-35)40(2,3)30-48-36-23-15-8-16-24-36/h5-24,31,35,37-39,42H,25-30H2,1-4H3/t31-,35-,37-,38-,39+,41-/m1/s1 |
| InChIKey | MMKFTYNNXCCMER-BBVSKSTISA-N |
| XLogP | 8.46 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.91 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |