C38H74O8SSi3 — CID 139249861
(2S,3S,4R,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxyoxan-4-ol (PubChem CID 139249861) has the molecular formula C38H74O8SSi3 and a molecular weight of 775.33 g/mol. Its IUPAC name is (2S,3S,4R,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxyoxan-4-ol.
| Compound Name | (2S,3S,4R,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 139249861 |
| Molecular Formula | C38H74O8SSi3 |
| Molecular Weight | 775.33 g/mol |
| Exact Mass | 774.44 |
| IUPAC Name | (2S,3S,4R,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxyoxan-4-ol |
| SMILES | CO[C@@]1(C(C)(C)CS(=O)(=O)c2ccccc2)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)C[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H74O8SSi3/c1-28(44-48(14,15)34(2,3)4)32(45-49(16,17)35(5,6)7)26-29-25-31(39)33(46-50(18,19)36(8,9)10)38(42-13,43-29)37(11,12)27-47(40,41)30-23-21-20-22-24-30/h20-24,28-29,31-33,39H,25-27H2,1-19H3/t28-,29+,31-,32-,33+,38-/m1/s1 |
| InChIKey | VDYWOTRZMIIIOH-BOYPOWSXSA-N |
| XLogP | 9.56 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.33 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|