C18H24O5 — CID 139250213
dimethyl (1Z,3R,11S)-9-oxotricyclo[9.3.0.03,7]tetradec-1-ene-5,5-dicarboxylate (PubChem CID 139250213) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is dimethyl (1Z,3R,11S)-9-oxotricyclo[9.3.0.03,7]tetradec-1-ene-5,5-dicarboxylate.
| Compound Name | dimethyl (1Z,3R,11S)-9-oxotricyclo[9.3.0.03,7]tetradec-1-ene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 139250213 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | dimethyl (1Z,3R,11S)-9-oxotricyclo[9.3.0.03,7]tetradec-1-ene-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2CC(=O)C[C@@H]3CCC/C3=C/[C@@H]2C1 |
| InChI | InChI=1S/C18H24O5/c1-22-16(20)18(17(21)23-2)9-13-6-11-4-3-5-12(11)7-15(19)8-14(13)10-18/h6,12-14H,3-5,7-10H2,1-2H3/b11-6-/t12-,13+,14?/m0/s1 |
| InChIKey | RYZYTLUXMPNHGM-LMSVRAMNSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|