C14H20O2 — CID 139250218
(1Z,3R,11S)-2-methyl-5-oxatricyclo[9.3.0.03,7]tetradec-1-en-9-one (PubChem CID 139250218) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1Z,3R,11S)-2-methyl-5-oxatricyclo[9.3.0.03,7]tetradec-1-en-9-one.
| Compound Name | (1Z,3R,11S)-2-methyl-5-oxatricyclo[9.3.0.03,7]tetradec-1-en-9-one |
|---|---|
| PubChem CID | 139250218 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1Z,3R,11S)-2-methyl-5-oxatricyclo[9.3.0.03,7]tetradec-1-en-9-one |
| SMILES | C/C1=C2\CCC[C@H]2CC(=O)CC2COC[C@@H]12 |
| InChI | InChI=1S/C14H20O2/c1-9-13-4-2-3-10(13)5-12(15)6-11-7-16-8-14(9)11/h10-11,14H,2-8H2,1H3/b13-9-/t10-,11?,14-/m0/s1 |
| InChIKey | LPCUWWLSMFMZGD-NABGYWFBSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|