C9H10N2O2 — CID 139250530
8-ethyl-3,5-dihydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 139250530) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 8-ethyl-3,5-dihydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 8-ethyl-3,5-dihydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139250530 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 8-ethyl-3,5-dihydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | CCC1=COCc2c1nc[nH]c2=O |
| InChI | InChI=1S/C9H10N2O2/c1-2-6-3-13-4-7-8(6)10-5-11-9(7)12/h3,5H,2,4H2,1H3,(H,10,11,12) |
| InChIKey | JGBPZEUTBUPXJM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |