C11H20N2O2 — CID 144917818
ethane;3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 144917818) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is ethane;3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | ethane;3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 144917818 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | ethane;3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | CC.CC.O=c1[nH]cnc2c1COCC2 |
| InChI | InChI=1S/C7H8N2O2.2C2H6/c10-7-5-3-11-2-1-6(5)8-4-9-7;2*1-2/h4H,1-3H2,(H,8,9,10);2*1-2H3 |
| InChIKey | CZWGPYJTVDXRLF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |