C21H20F3NO3S — CID 139250876
(3S,3aR,6aR)-2-(4-methylphenyl)sulfonyl-3-phenyl-3a-(trifluoromethyl)-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-5-one (PubChem CID 139250876) has the molecular formula C21H20F3NO3S and a molecular weight of 423.46 g/mol. Its IUPAC name is (3S,3aR,6aR)-2-(4-methylphenyl)sulfonyl-3-phenyl-3a-(trifluoromethyl)-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-5-one.
| Compound Name | (3S,3aR,6aR)-2-(4-methylphenyl)sulfonyl-3-phenyl-3a-(trifluoromethyl)-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 139250876 |
| Molecular Formula | C21H20F3NO3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (3S,3aR,6aR)-2-(4-methylphenyl)sulfonyl-3-phenyl-3a-(trifluoromethyl)-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CC(=O)C[C@]3(C(F)(F)F)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20F3NO3S/c1-14-7-9-18(10-8-14)29(27,28)25-13-16-11-17(26)12-20(16,21(22,23)24)19(25)15-5-3-2-4-6-15/h2-10,16,19H,11-13H2,1H3/t16-,19-,20+/m0/s1 |
| InChIKey | BVSMNNCXYRARIU-FFZOFVMBSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |