C21H23NO3S — CID 134944475
1-[(3S,4R,5S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]ethanone (PubChem CID 134944475) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[(3S,4R,5S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]ethanone.
| Compound Name | 1-[(3S,4R,5S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 134944475 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(3S,4R,5S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]ethanone |
| SMILES | C=C[C@H]1[C@@H](c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(C)=O |
| InChI | InChI=1S/C21H23NO3S/c1-4-19-20(16(3)23)14-22(21(19)17-8-6-5-7-9-17)26(24,25)18-12-10-15(2)11-13-18/h4-13,19-21H,1,14H2,2-3H3/t19-,20+,21-/m1/s1 |
| InChIKey | BAFGCHZKKMYRDI-QHAWAJNXSA-N |
| XLogP | 3.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|