C16H26O6 — CID 139250910
dipropan-2-yl (2S)-2-[(S)-acetyloxy(deuterio)methyl]cyclopentane-1,1-dicarboxylate (PubChem CID 139250910) has the molecular formula C16H26O6 and a molecular weight of 315.38 g/mol. Its IUPAC name is dipropan-2-yl (2S)-2-[(S)-acetyloxy(deuterio)methyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | dipropan-2-yl (2S)-2-[(S)-acetyloxy(deuterio)methyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139250910 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | dipropan-2-yl (2S)-2-[(S)-acetyloxy(deuterio)methyl]cyclopentane-1,1-dicarboxylate |
| SMILES | [2H][C@H](OC(C)=O)[C@H]1CCCC1(C(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H26O6/c1-10(2)21-14(18)16(15(19)22-11(3)4)8-6-7-13(16)9-20-12(5)17/h10-11,13H,6-9H2,1-5H3/t13-/m1/s1/i9D/t9-,13+/m0 |
| InChIKey | RLAGPODSMDUXEW-UOBBQXSFSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|