C37H35BrN2O7 — CID 139251138
2-(2-bromo-4,5-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-N-phenyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide (PubChem CID 139251138) has the molecular formula C37H35BrN2O7 and a molecular weight of 699.60 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-N-phenyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-N-phenyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139251138 |
| Molecular Formula | C37H35BrN2O7 |
| Molecular Weight | 699.60 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-N-phenyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
| SMILES | COc1ccc(-c2c(-c3cc(OC)c(OC)cc3Br)c(C(=O)Nc3ccccc3)n3c2-c2cc(OC)c(OC)cc2CC3)cc1OC |
| InChI | InChI=1S/C37H35BrN2O7/c1-42-27-13-12-22(17-28(27)43-2)33-34(25-19-31(46-5)32(47-6)20-26(25)38)36(37(41)39-23-10-8-7-9-11-23)40-15-14-21-16-29(44-3)30(45-4)18-24(21)35(33)40/h7-13,16-20H,14-15H2,1-6H3,(H,39,41) |
| InChIKey | CIXOYEBSLGYKQH-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |