C24H24N2O8 — CID 16726774
methyl 2-(3,4-dimethoxyphenyl)-8,9-dimethoxy-1-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 16726774) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is methyl 2-(3,4-dimethoxyphenyl)-8,9-dimethoxy-1-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(3,4-dimethoxyphenyl)-8,9-dimethoxy-1-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 16726774 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | methyl 2-(3,4-dimethoxyphenyl)-8,9-dimethoxy-1-nitro-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)c(OC)c2)c([N+](=O)[O-])c2n1CCc1cc(OC)c(OC)cc1-2 |
| InChI | InChI=1S/C24H24N2O8/c1-30-16-7-6-14(11-17(16)31-2)20-22(26(28)29)21-15-12-19(33-4)18(32-3)10-13(15)8-9-25(21)23(20)24(27)34-5/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | KQMSPTFTYIPZTJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|