C48H64NO14S2+ — CID 139251877
bis[[4-[3-(2-sulfanylacetyl)oxypropoxy]phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene (PubChem CID 139251877) has the molecular formula C48H64NO14S2+ and a molecular weight of 943.17 g/mol. Its IUPAC name is bis[[4-[3-(2-sulfanylacetyl)oxypropoxy]phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene.
| Compound Name | bis[[4-[3-(2-sulfanylacetyl)oxypropoxy]phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
|---|---|
| PubChem CID | 139251877 |
| Molecular Formula | C48H64NO14S2+ |
| Molecular Weight | 943.17 g/mol |
| Exact Mass | 942.38 |
| IUPAC Name | bis[[4-[3-(2-sulfanylacetyl)oxypropoxy]phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
| SMILES | O=C(CS)OCCCOc1ccc(C[NH2+]Cc2ccc(OCCCOC(=O)CS)cc2)cc1.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H31NO6S2.C24H32O8/c26-23(17-32)30-13-1-11-28-21-7-3-19(4-8-21)15-25-16-20-5-9-22(10-6-20)29-12-2-14-31-24(27)18-33;1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22/h3-10,25,32-33H,1-2,11-18H2;1-8H,9-20H2/p+1 |
| InChIKey | AEMIZRXPVRZVRP-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.17 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|