C29H48SSi — CID 139252406
[(Z)-3-pentyl-4-phenylsulfanylnon-3-en-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 139252406) has the molecular formula C29H48SSi and a molecular weight of 456.86 g/mol. Its IUPAC name is [(Z)-3-pentyl-4-phenylsulfanylnon-3-en-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(Z)-3-pentyl-4-phenylsulfanylnon-3-en-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139252406 |
| Molecular Formula | C29H48SSi |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | [(Z)-3-pentyl-4-phenylsulfanylnon-3-en-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCCCC/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(\CCCCC)Sc1ccccc1 |
| InChI | InChI=1S/C29H48SSi/c1-9-11-14-18-27(22-23-31(24(3)4,25(5)6)26(7)8)29(21-15-12-10-2)30-28-19-16-13-17-20-28/h13,16-17,19-20,24-26H,9-12,14-15,18,21H2,1-8H3/b29-27- |
| InChIKey | MQEUUCQHHSTXCH-OHYPFYFLSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|