C22H48O2Si3 — CID 139252748
5,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl-trimethylsilane (PubChem CID 139252748) has the molecular formula C22H48O2Si3 and a molecular weight of 428.88 g/mol. Its IUPAC name is 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl-trimethylsilane.
| Compound Name | 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 139252748 |
| Molecular Formula | C22H48O2Si3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O2Si3/c1-21(2,3)26(10,11)23-18-17-20(16-14-15-19-25(7,8)9)24-27(12,13)22(4,5)6/h20H,14,16-18H2,1-13H3 |
| InChIKey | SXLPLFBBCBTFFU-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|