C19H20ClNO4 — CID 139253150
(E)-3-(4-chlorophenyl)prop-2-enoic acid;methyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 139253150) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)prop-2-enoic acid;methyl (2S)-2-amino-3-phenylpropanoate.
| Compound Name | (E)-3-(4-chlorophenyl)prop-2-enoic acid;methyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 139253150 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)prop-2-enoic acid;methyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccccc1.O=C(O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13NO2.C9H7ClO2/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;10-8-4-1-7(2-5-8)3-6-9(11)12/h2-6,9H,7,11H2,1H3;1-6H,(H,11,12)/b;6-3+/t9-;/m0./s1 |
| InChIKey | VSIQEICPNGZPGX-DZDOVTDBSA-N |
| XLogP | 3.17 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|