C55H51N7O5Zn2+2 — CID 139253216
zinc;methyl (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[[2-(pyren-1-ylmethoxy)acetyl]amino]propanoate;zinc (PubChem CID 139253216) has the molecular formula C55H51N7O5Zn2+2 and a molecular weight of 1020.84 g/mol. Its IUPAC name is zinc;methyl (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[[2-(pyren-1-ylmethoxy)acetyl]amino]propanoate;zinc.
| Compound Name | zinc;methyl (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[[2-(pyren-1-ylmethoxy)acetyl]amino]propanoate;zinc |
|---|---|
| PubChem CID | 139253216 |
| Molecular Formula | C55H51N7O5Zn2+2 |
| Molecular Weight | 1020.84 g/mol |
| Exact Mass | 1017.25 |
| IUPAC Name | zinc;methyl (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[[2-(pyren-1-ylmethoxy)acetyl]amino]propanoate;zinc |
| SMILES | COC(=O)[C@H](Cc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1)NC(=O)COCc1ccc2ccc3cccc4ccc1c2c34.[Zn+2].[Zn] |
| InChI | InChI=1S/C55H51N7O5.2Zn/c1-66-55(65)50(60-51(63)37-67-36-42-20-19-41-18-17-39-11-10-12-40-21-22-49(42)53(41)52(39)40)29-38-27-43(30-61(32-45-13-2-6-23-56-45)33-46-14-3-7-24-57-46)54(64)44(28-38)31-62(34-47-15-4-8-25-58-47)35-48-16-5-9-26-59-48;;/h2-28,50,64H,29-37H2,1H3,(H,60,63);;/q;;+2/t50-;;/m0../s1 |
| InChIKey | XOKFUOWRLSRNOQ-WTUKUHAWSA-N |
| XLogP | 8.69 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.84 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|