C16H18BrN3O2 — CID 139253567
2-(3-azidopropyl)-2-[(4-bromophenyl)methyl]cyclohexane-1,3-dione (PubChem CID 139253567) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 2-(3-azidopropyl)-2-[(4-bromophenyl)methyl]cyclohexane-1,3-dione.
| Compound Name | 2-(3-azidopropyl)-2-[(4-bromophenyl)methyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 139253567 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(3-azidopropyl)-2-[(4-bromophenyl)methyl]cyclohexane-1,3-dione |
| SMILES | [N-]=[N+]=NCCCC1(Cc2ccc(Br)cc2)C(=O)CCCC1=O |
| InChI | InChI=1S/C16H18BrN3O2/c17-13-7-5-12(6-8-13)11-16(9-2-10-19-20-18)14(21)3-1-4-15(16)22/h5-8H,1-4,9-11H2 |
| InChIKey | KJCWSUSTEGORES-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|