About benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate
benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate (PubChem CID 121277772) has the molecular formula C17H17BrN4O3S
and a molecular weight of 437.32 g/mol. Its IUPAC name is benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 121277772 |
| Molecular Formula | C17H17BrN4O3S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate |
| SMILES | [N-]=[N+]=NCCCS(=O)(=NC(=O)OCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN4O3S/c18-15-7-9-16(10-8-15)26(24,12-4-11-20-22-19)21-17(23)25-13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2 |
| InChIKey | LIGDNQRVZVOULU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 104.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate (CID 121277772) is benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate is [N-]=[N+]=NCCCS(=O)(=NC(=O)OCc1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is LIGDNQRVZVOULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN4O3S/c18-15-7-9-16(10-8-15)26(24,12-4-11-20-22-19)21-17(23)25-13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2.
What are the key properties of benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate?
benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 437.32 g/mol, XLogP of 5.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[3-azidopropyl-(4-bromophenyl)-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 121277772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).