C16H24F3NO3S — CID 139253711
triethyl-[(E)-3-phenylprop-2-enyl]azanium;trifluoromethanesulfonate (PubChem CID 139253711) has the molecular formula C16H24F3NO3S and a molecular weight of 367.43 g/mol. Its IUPAC name is triethyl-[(E)-3-phenylprop-2-enyl]azanium;trifluoromethanesulfonate.
| Compound Name | triethyl-[(E)-3-phenylprop-2-enyl]azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139253711 |
| Molecular Formula | C16H24F3NO3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | triethyl-[(E)-3-phenylprop-2-enyl]azanium;trifluoromethanesulfonate |
| SMILES | CC[N+](CC)(CC)C/C=C/c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H24N.CHF3O3S/c1-4-16(5-2,6-3)14-10-13-15-11-8-7-9-12-15;2-1(3,4)8(5,6)7/h7-13H,4-6,14H2,1-3H3;(H,5,6,7)/q+1;/p-1/b13-10+; |
| InChIKey | KKTFAYHZKOUCIW-RSGUCCNWSA-M |
| XLogP | 3.63 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|